C15H18F2O — CID 143612329
5-(4-ethenylcyclohexen-1-yl)-1,6-difluoro-2-methoxycyclohexa-1,3-diene (PubChem CID 143612329) has the molecular formula C15H18F2O and a molecular weight of 252.30 g/mol. Its IUPAC name is 5-(4-ethenylcyclohexen-1-yl)-1,6-difluoro-2-methoxycyclohexa-1,3-diene.
| Compound Name | 5-(4-ethenylcyclohexen-1-yl)-1,6-difluoro-2-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143612329 |
| Molecular Formula | C15H18F2O |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 5-(4-ethenylcyclohexen-1-yl)-1,6-difluoro-2-methoxycyclohexa-1,3-diene |
| SMILES | C=CC1CC=C(C2C=CC(OC)=C(F)C2F)CC1 |
| InChI | InChI=1S/C15H18F2O/c1-3-10-4-6-11(7-5-10)12-8-9-13(18-2)15(17)14(12)16/h3,6,8-10,12,14H,1,4-5,7H2,2H3 |
| InChIKey | OAHMXMGOZRINHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|