C17H20N2 — CID 143613959
N-methyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)aniline (PubChem CID 143613959) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-methyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)aniline.
| Compound Name | N-methyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)aniline |
|---|---|
| PubChem CID | 143613959 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-methyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)aniline |
| SMILES | CNc1ccc(-c2ccc3c(c2)CN(C)CC3)cc1 |
| InChI | InChI=1S/C17H20N2/c1-18-17-7-5-13(6-8-17)15-4-3-14-9-10-19(2)12-16(14)11-15/h3-8,11,18H,9-10,12H2,1-2H3 |
| InChIKey | RRRUFUGJIYWBSJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |