C11H17FN2O2 — CID 143614470
ethane;[(2-fluorophenyl)methyl-methylamino]carbamic acid (PubChem CID 143614470) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is ethane;[(2-fluorophenyl)methyl-methylamino]carbamic acid.
| Compound Name | ethane;[(2-fluorophenyl)methyl-methylamino]carbamic acid |
|---|---|
| PubChem CID | 143614470 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;[(2-fluorophenyl)methyl-methylamino]carbamic acid |
| SMILES | CC.CN(Cc1ccccc1F)NC(=O)O |
| InChI | InChI=1S/C9H11FN2O2.C2H6/c1-12(11-9(13)14)6-7-4-2-3-5-8(7)10;1-2/h2-5,11H,6H2,1H3,(H,13,14);1-2H3 |
| InChIKey | AYUQVGZAWFMMFS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|