C22H28Cl2N2O3 — CID 143615187
[(3Z,6E)-6-chloroocta-3,6-dien-2-yl] 2-[(4-chlorophenyl)methyl-methylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 143615187) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is [(3Z,6E)-6-chloroocta-3,6-dien-2-yl] 2-[(4-chlorophenyl)methyl-methylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | [(3Z,6E)-6-chloroocta-3,6-dien-2-yl] 2-[(4-chlorophenyl)methyl-methylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143615187 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [(3Z,6E)-6-chloroocta-3,6-dien-2-yl] 2-[(4-chlorophenyl)methyl-methylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C/C=C(/Cl)C/C=C\C(C)OC(=O)N1CCCC1C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28Cl2N2O3/c1-4-18(23)8-5-7-16(2)29-22(28)26-14-6-9-20(26)21(27)25(3)15-17-10-12-19(24)13-11-17/h4-5,7,10-13,16,20H,6,8-9,14-15H2,1-3H3/b7-5-,18-4+ |
| InChIKey | UHUJYAREHXTHKW-IEEHNQBISA-N |
| XLogP | 5.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|