C23H17Cl3N2O2S — CID 143618355
2-[2-[4-chloro-3-[(3,5-dichlorophenyl)methylamino]sulfanylphenyl]-1H-indol-3-yl]acetic acid (PubChem CID 143618355) has the molecular formula C23H17Cl3N2O2S and a molecular weight of 491.83 g/mol. Its IUPAC name is 2-[2-[4-chloro-3-[(3,5-dichlorophenyl)methylamino]sulfanylphenyl]-1H-indol-3-yl]acetic acid.
| Compound Name | 2-[2-[4-chloro-3-[(3,5-dichlorophenyl)methylamino]sulfanylphenyl]-1H-indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143618355 |
| Molecular Formula | C23H17Cl3N2O2S |
| Molecular Weight | 491.83 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 2-[2-[4-chloro-3-[(3,5-dichlorophenyl)methylamino]sulfanylphenyl]-1H-indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1c(-c2ccc(Cl)c(SNCc3cc(Cl)cc(Cl)c3)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H17Cl3N2O2S/c24-15-7-13(8-16(25)10-15)12-27-31-21-9-14(5-6-19(21)26)23-18(11-22(29)30)17-3-1-2-4-20(17)28-23/h1-10,27-28H,11-12H2,(H,29,30) |
| InChIKey | LJKZKUZYQOCPMD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.83 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|