C27H37ClN2O4S — CID 173172440
2-[2-[4-chloro-3-(cyclooctylmethylsulfamoyl)phenyl]-1H-indol-3-yl]acetic acid;methane (PubChem CID 173172440) has the molecular formula C27H37ClN2O4S and a molecular weight of 521.12 g/mol. Its IUPAC name is 2-[2-[4-chloro-3-(cyclooctylmethylsulfamoyl)phenyl]-1H-indol-3-yl]acetic acid;methane.
| Compound Name | 2-[2-[4-chloro-3-(cyclooctylmethylsulfamoyl)phenyl]-1H-indol-3-yl]acetic acid;methane |
|---|---|
| PubChem CID | 173172440 |
| Molecular Formula | C27H37ClN2O4S |
| Molecular Weight | 521.12 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-[2-[4-chloro-3-(cyclooctylmethylsulfamoyl)phenyl]-1H-indol-3-yl]acetic acid;methane |
| SMILES | C.C.O=C(O)Cc1c(-c2ccc(Cl)c(S(=O)(=O)NCC3CCCCCCC3)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H29ClN2O4S.2CH4/c26-21-13-12-18(25-20(15-24(29)30)19-10-6-7-11-22(19)28-25)14-23(21)33(31,32)27-16-17-8-4-2-1-3-5-9-17;;/h6-7,10-14,17,27-28H,1-5,8-9,15-16H2,(H,29,30);2*1H4 |
| InChIKey | GDTGXYBQNFBJDB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.12 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |