C23H24Cl2N2O4S — CID 69471701
methyl 2-[5-chloro-2-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]acetate (PubChem CID 69471701) has the molecular formula C23H24Cl2N2O4S and a molecular weight of 495.43 g/mol. Its IUPAC name is methyl 2-[5-chloro-2-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]acetate.
| Compound Name | methyl 2-[5-chloro-2-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 69471701 |
| Molecular Formula | C23H24Cl2N2O4S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | methyl 2-[5-chloro-2-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c(-c2ccc(Cl)c(S(=O)(=O)NC3CCCCC3)c2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H24Cl2N2O4S/c1-31-22(28)13-18-17-12-15(24)8-10-20(17)26-23(18)14-7-9-19(25)21(11-14)32(29,30)27-16-5-3-2-4-6-16/h7-12,16,26-27H,2-6,13H2,1H3 |
| InChIKey | HSMZAROXGGCKOL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |