C24H28N2O4S — CID 150203480
[2-[3-(cyclohexylsulfamoyl)-4-methylphenyl]-1H-indol-3-yl]methyl acetate (PubChem CID 150203480) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is [2-[3-(cyclohexylsulfamoyl)-4-methylphenyl]-1H-indol-3-yl]methyl acetate.
| Compound Name | [2-[3-(cyclohexylsulfamoyl)-4-methylphenyl]-1H-indol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 150203480 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-[3-(cyclohexylsulfamoyl)-4-methylphenyl]-1H-indol-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2ccc(C)c(S(=O)(=O)NC3CCCCC3)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H28N2O4S/c1-16-12-13-18(14-23(16)31(28,29)26-19-8-4-3-5-9-19)24-21(15-30-17(2)27)20-10-6-7-11-22(20)25-24/h6-7,10-14,19,25-26H,3-5,8-9,15H2,1-2H3 |
| InChIKey | FPZDOSVUVAJUMA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |