C23H25ClN2O4S — CID 174536911
[2-[3-(4-chlorocyclohexyl)-2-sulfamoylphenyl]-1H-indol-3-yl]methyl acetate (PubChem CID 174536911) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is [2-[3-(4-chlorocyclohexyl)-2-sulfamoylphenyl]-1H-indol-3-yl]methyl acetate.
| Compound Name | [2-[3-(4-chlorocyclohexyl)-2-sulfamoylphenyl]-1H-indol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 174536911 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [2-[3-(4-chlorocyclohexyl)-2-sulfamoylphenyl]-1H-indol-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2cccc(C3CCC(Cl)CC3)c2S(N)(=O)=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-14(27)30-13-20-18-5-2-3-8-21(18)26-22(20)19-7-4-6-17(23(19)31(25,28)29)15-9-11-16(24)12-10-15/h2-8,15-16,26H,9-13H2,1H3,(H2,25,28,29) |
| InChIKey | HUKHIHFCRKDXRV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|