C23H26N2O4S — CID 151813192
[2-[4-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]methyl acetate (PubChem CID 151813192) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is [2-[4-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]methyl acetate.
| Compound Name | [2-[4-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 151813192 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-[4-(cyclohexylsulfamoyl)phenyl]-1H-indol-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2ccc(S(=O)(=O)NC3CCCCC3)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H26N2O4S/c1-16(26)29-15-21-20-9-5-6-10-22(20)24-23(21)17-11-13-19(14-12-17)30(27,28)25-18-7-3-2-4-8-18/h5-6,9-14,18,24-25H,2-4,7-8,15H2,1H3 |
| InChIKey | SBAVHVCONOYFEC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |