C13H17N — CID 143618595
4-butyl-7,8-dihydroquinoline (PubChem CID 143618595) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-butyl-7,8-dihydroquinoline.
| Compound Name | 4-butyl-7,8-dihydroquinoline |
|---|---|
| PubChem CID | 143618595 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-butyl-7,8-dihydroquinoline |
| SMILES | CCCCc1ccnc2c1C=CCC2 |
| InChI | InChI=1S/C13H17N/c1-2-3-6-11-9-10-14-13-8-5-4-7-12(11)13/h4,7,9-10H,2-3,5-6,8H2,1H3 |
| InChIKey | CLMDENHQTSKAAE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |