C16H20 — CID 173142275
1-butyl-2-cyclohexa-1,5-dien-1-ylbenzene (PubChem CID 173142275) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-butyl-2-cyclohexa-1,5-dien-1-ylbenzene.
| Compound Name | 1-butyl-2-cyclohexa-1,5-dien-1-ylbenzene |
|---|---|
| PubChem CID | 173142275 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 1-butyl-2-cyclohexa-1,5-dien-1-ylbenzene |
| SMILES | CCCCc1ccccc1C1=CCCC=C1 |
| InChI | InChI=1S/C16H20/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15/h5,7-8,10-13H,2-4,6,9H2,1H3 |
| InChIKey | WHUJRHUBEKLLRP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |