C39H61N — CID 143619253
5-prop-1-en-2-yl-N,N-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexa-1,5-dien-1-amine (PubChem CID 143619253) has the molecular formula C39H61N and a molecular weight of 543.92 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-N,N-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | 5-prop-1-en-2-yl-N,N-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143619253 |
| Molecular Formula | C39H61N |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.48 |
| IUPAC Name | 5-prop-1-en-2-yl-N,N-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C)C1=CC(N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C/C=C(\C)CC/C=C(\C)CCC=C(C)C)=CCC1 |
| InChI | InChI=1S/C39H61N/c1-31(2)16-11-18-34(7)20-13-22-36(9)26-28-40(39-25-15-24-38(30-39)33(5)6)29-27-37(10)23-14-21-35(8)19-12-17-32(3)4/h16-17,20-21,25-27,30H,5,11-15,18-19,22-24,28-29H2,1-4,6-10H3/b34-20+,35-21+,36-26+,37-27+ |
| InChIKey | GYXCXTIXZRQFPS-XETVTNPMSA-N |
| XLogP | 12.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|