C31H31N3O4S — CID 143623852
3-[2-ethoxyethyl-(4-ethynylcyclohexanecarbonyl)amino]-5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-carboxylic acid (PubChem CID 143623852) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is 3-[2-ethoxyethyl-(4-ethynylcyclohexanecarbonyl)amino]-5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-[2-ethoxyethyl-(4-ethynylcyclohexanecarbonyl)amino]-5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 143623852 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 3-[2-ethoxyethyl-(4-ethynylcyclohexanecarbonyl)amino]-5-(4-imidazo[1,2-a]pyridin-2-ylphenyl)thiophene-2-carboxylic acid |
| SMILES | C#CC1CCC(C(=O)N(CCOCC)c2cc(-c3ccc(-c4cn5ccccc5n4)cc3)sc2C(=O)O)CC1 |
| InChI | InChI=1S/C31H31N3O4S/c1-3-21-8-10-24(11-9-21)30(35)34(17-18-38-4-2)26-19-27(39-29(26)31(36)37)23-14-12-22(13-15-23)25-20-33-16-6-5-7-28(33)32-25/h1,5-7,12-16,19-21,24H,4,8-11,17-18H2,2H3,(H,36,37) |
| InChIKey | VGHZTAZWJCOZFP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|