C17H24N2O2 — CID 143626581
N,N-dimethylcyclohexanamine;6-hydroxy-2H-isoquinolin-1-one (PubChem CID 143626581) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N,N-dimethylcyclohexanamine;6-hydroxy-2H-isoquinolin-1-one.
| Compound Name | N,N-dimethylcyclohexanamine;6-hydroxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 143626581 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N,N-dimethylcyclohexanamine;6-hydroxy-2H-isoquinolin-1-one |
| SMILES | CN(C)C1CCCCC1.O=c1[nH]ccc2cc(O)ccc12 |
| InChI | InChI=1S/C9H7NO2.C8H17N/c11-7-1-2-8-6(5-7)3-4-10-9(8)12;1-9(2)8-6-4-3-5-7-8/h1-5,11H,(H,10,12);8H,3-7H2,1-2H3 |
| InChIKey | FUJLYSPMRJYIEQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |