C27H35N3O2S — CID 143627834
4-ethyl-6-[1-[(5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-2-yl)-(sulfanylmethyl)amino]ethenyl]benzene-1,3-diol;N-methylmethanimine (PubChem CID 143627834) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 4-ethyl-6-[1-[(5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-2-yl)-(sulfanylmethyl)amino]ethenyl]benzene-1,3-diol;N-methylmethanimine.
| Compound Name | 4-ethyl-6-[1-[(5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-2-yl)-(sulfanylmethyl)amino]ethenyl]benzene-1,3-diol;N-methylmethanimine |
|---|---|
| PubChem CID | 143627834 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 4-ethyl-6-[1-[(5-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indol-2-yl)-(sulfanylmethyl)amino]ethenyl]benzene-1,3-diol;N-methylmethanimine |
| SMILES | C=C(c1cc(CC)c(O)cc1O)N(CS)c1ccc2c(c1)c1c(n2C)CCCCC1.C=NC |
| InChI | InChI=1S/C25H30N2O2S.C2H5N/c1-4-17-12-20(25(29)14-24(17)28)16(2)27(15-30)18-10-11-23-21(13-18)19-8-6-5-7-9-22(19)26(23)3;1-3-2/h10-14,28-30H,2,4-9,15H2,1,3H3;1H2,2H3 |
| InChIKey | UGVRWBRLEYVZPC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|