C24H22F2N4 — CID 143629536
3-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2,4-difluorophenyl]-N'-methanimidoylbenzenecarboximidamide (PubChem CID 143629536) has the molecular formula C24H22F2N4 and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2,4-difluorophenyl]-N'-methanimidoylbenzenecarboximidamide.
| Compound Name | 3-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2,4-difluorophenyl]-N'-methanimidoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143629536 |
| Molecular Formula | C24H22F2N4 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2,4-difluorophenyl]-N'-methanimidoylbenzenecarboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1cccc(-c2ccc(F)c(CNC3Cc4ccccc4C3)c2F)c1 |
| InChI | InChI=1S/C24H22F2N4/c25-22-9-8-20(17-6-3-7-18(10-17)24(28)30-14-27)23(26)21(22)13-29-19-11-15-4-1-2-5-16(15)12-19/h1-10,14,19,29H,11-13H2,(H3,27,28,30) |
| InChIKey | GPJOQKSNUAMFAG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|