C24H23FN4 — CID 143629632
4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2-fluorophenyl]-N'-methanimidoylbenzenecarboximidamide (PubChem CID 143629632) has the molecular formula C24H23FN4 and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2-fluorophenyl]-N'-methanimidoylbenzenecarboximidamide.
| Compound Name | 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2-fluorophenyl]-N'-methanimidoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143629632 |
| Molecular Formula | C24H23FN4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[3-[(2,3-dihydro-1H-inden-2-ylamino)methyl]-2-fluorophenyl]-N'-methanimidoylbenzenecarboximidamide |
| SMILES | [H]/N=C/N=C(\N)c1ccc(-c2cccc(CNC3Cc4ccccc4C3)c2F)cc1 |
| InChI | InChI=1S/C24H23FN4/c25-23-20(14-28-21-12-18-4-1-2-5-19(18)13-21)6-3-7-22(23)16-8-10-17(11-9-16)24(27)29-15-26/h1-11,15,21,28H,12-14H2,(H3,26,27,29) |
| InChIKey | WTWOCTQHAAPFEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|