C18H22N4O2 — CID 143631229
(2E,5E)-6-[6-(1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid (PubChem CID 143631229) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2E,5E)-6-[6-(1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid.
| Compound Name | (2E,5E)-6-[6-(1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 143631229 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2E,5E)-6-[6-(1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid |
| SMILES | C=C/C(=C\C(=C)/C=C/C(=O)O)c1cncc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C18H22N4O2/c1-3-15(11-14(2)5-6-18(23)24)16-12-20-13-17(21-16)22-9-4-7-19-8-10-22/h3,5-6,11-13,19H,1-2,4,7-10H2,(H,23,24)/b6-5+,15-11+ |
| InChIKey | VDIJTTBXCRNOPG-GCXOIEGYSA-N |
| XLogP | 2.04 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|