C25H28N4O2 — CID 143631272
(2E,5E)-6-[6-(4-benzyl-1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid (PubChem CID 143631272) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is (2E,5E)-6-[6-(4-benzyl-1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid.
| Compound Name | (2E,5E)-6-[6-(4-benzyl-1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 143631272 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2E,5E)-6-[6-(4-benzyl-1,4-diazepan-1-yl)pyrazin-2-yl]-4-methylideneocta-2,5,7-trienoic acid |
| SMILES | C=C/C(=C\C(=C)/C=C/C(=O)O)c1cncc(N2CCCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H28N4O2/c1-3-22(16-20(2)10-11-25(30)31)23-17-26-18-24(27-23)29-13-7-12-28(14-15-29)19-21-8-5-4-6-9-21/h3-6,8-11,16-18H,1-2,7,12-15,19H2,(H,30,31)/b11-10+,22-16+ |
| InChIKey | DCKUPSHQSKPPNJ-YYMYKZPXSA-N |
| XLogP | 3.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|