C26H33N4O3S2+ — CID 143637718
N-[3-[(2E)-3,3-dimethyl-2-[(E,4Z)-4-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-3-ium-5-ylidene)but-2-enylidene]-5-sulfanylindol-1-yl]propyl]butanamide (PubChem CID 143637718) has the molecular formula C26H33N4O3S2+ and a molecular weight of 513.71 g/mol. Its IUPAC name is N-[3-[(2E)-3,3-dimethyl-2-[(E,4Z)-4-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-3-ium-5-ylidene)but-2-enylidene]-5-sulfanylindol-1-yl]propyl]butanamide.
| Compound Name | N-[3-[(2E)-3,3-dimethyl-2-[(E,4Z)-4-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-3-ium-5-ylidene)but-2-enylidene]-5-sulfanylindol-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 143637718 |
| Molecular Formula | C26H33N4O3S2+ |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-[3-[(2E)-3,3-dimethyl-2-[(E,4Z)-4-(1-methyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-3-ium-5-ylidene)but-2-enylidene]-5-sulfanylindol-1-yl]propyl]butanamide |
| SMILES | CCCC(=O)NCCCN1/C(=C/C=C/C=C2/C(=O)[NH2+]C(=S)N(C)C2=O)C(C)(C)c2cc(S)ccc21 |
| InChI | InChI=1S/C26H32N4O3S2/c1-5-9-22(31)27-14-8-15-30-20-13-12-17(34)16-19(20)26(2,3)21(30)11-7-6-10-18-23(32)28-25(35)29(4)24(18)33/h6-7,10-13,16,34H,5,8-9,14-15H2,1-4H3,(H,27,31)(H,28,32,35)/p+1/b7-6+,18-10-,21-11+ |
| InChIKey | SEZXMAYXRRLPBH-HTCFUOEBSA-O |
| XLogP | 2.59 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|