C39H46N4O2S — CID 143637645
(2E,4E,6E)-N-benzyl-2-[1-(benzylamino)ethenyl]-6-[3,3-dimethyl-5-methylsulfanyl-1-[3-(propanoylamino)propyl]indol-2-ylidene]hexa-2,4-dienamide (PubChem CID 143637645) has the molecular formula C39H46N4O2S and a molecular weight of 634.89 g/mol. Its IUPAC name is (2E,4E,6E)-N-benzyl-2-[1-(benzylamino)ethenyl]-6-[3,3-dimethyl-5-methylsulfanyl-1-[3-(propanoylamino)propyl]indol-2-ylidene]hexa-2,4-dienamide.
| Compound Name | (2E,4E,6E)-N-benzyl-2-[1-(benzylamino)ethenyl]-6-[3,3-dimethyl-5-methylsulfanyl-1-[3-(propanoylamino)propyl]indol-2-ylidene]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 143637645 |
| Molecular Formula | C39H46N4O2S |
| Molecular Weight | 634.89 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | (2E,4E,6E)-N-benzyl-2-[1-(benzylamino)ethenyl]-6-[3,3-dimethyl-5-methylsulfanyl-1-[3-(propanoylamino)propyl]indol-2-ylidene]hexa-2,4-dienamide |
| SMILES | C=C(NCc1ccccc1)/C(=C\C=C\C=C1\N(CCCNC(=O)CC)c2ccc(SC)cc2C1(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C39H46N4O2S/c1-6-37(44)40-24-15-25-43-35-23-22-32(46-5)26-34(35)39(3,4)36(43)21-14-13-20-33(29(2)41-27-30-16-9-7-10-17-30)38(45)42-28-31-18-11-8-12-19-31/h7-14,16-23,26,41H,2,6,15,24-25,27-28H2,1,3-5H3,(H,40,44)(H,42,45)/b14-13+,33-20+,36-21+ |
| InChIKey | LMXBAVXGLHUZMI-RKAKCXHQSA-N |
| XLogP | 7.41 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.89 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|