C30H35ClN3O3S3+ — CID 143637695
2-chloro-N-[3-[(2Z)-5-hydroxysulfanyl-2-[(2E,4E)-5-[3-(3-hydroxysulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]propyl]acetamide (PubChem CID 143637695) has the molecular formula C30H35ClN3O3S3+ and a molecular weight of 617.28 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2Z)-5-hydroxysulfanyl-2-[(2E,4E)-5-[3-(3-hydroxysulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]propyl]acetamide.
| Compound Name | 2-chloro-N-[3-[(2Z)-5-hydroxysulfanyl-2-[(2E,4E)-5-[3-(3-hydroxysulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 143637695 |
| Molecular Formula | C30H35ClN3O3S3+ |
| Molecular Weight | 617.28 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | 2-chloro-N-[3-[(2Z)-5-hydroxysulfanyl-2-[(2E,4E)-5-[3-(3-hydroxysulfanylpropyl)-1,3-benzothiazol-3-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]propyl]acetamide |
| SMILES | CC1(C)/C(=C/C=C/C=C/c2sc3ccccc3[n+]2CCCSO)N(CCCNC(=O)CCl)c2ccc(SO)cc21 |
| InChI | InChI=1S/C30H34ClN3O3S3/c1-30(2)23-20-22(40-37)14-15-24(23)33(17-8-16-32-28(35)21-31)27(30)12-4-3-5-13-29-34(18-9-19-38-36)25-10-6-7-11-26(25)39-29/h3-7,10-15,20H,8-9,16-19,21H2,1-2H3,(H2-,32,35,36,37)/p+1 |
| InChIKey | NYIPKMHPGZHDMC-UHFFFAOYSA-O |
| XLogP | 7.35 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.28 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|