C38H51N3O2S+2 — CID 87910445
3-[(2E)-2-[(2E,4E,6E)-7-[3-(3-ethoxy-3-oxopropyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium (PubChem CID 87910445) has the molecular formula C38H51N3O2S+2 and a molecular weight of 613.91 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E,6E)-7-[3-(3-ethoxy-3-oxopropyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium.
| Compound Name | 3-[(2E)-2-[(2E,4E,6E)-7-[3-(3-ethoxy-3-oxopropyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium |
|---|---|
| PubChem CID | 87910445 |
| Molecular Formula | C38H51N3O2S+2 |
| Molecular Weight | 613.91 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E,6E)-7-[3-(3-ethoxy-3-oxopropyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]propyl-triethylazanium |
| SMILES | CCOC(=O)CC[n+]1c(/C=C/C=C/C=C/C=C2/N(CCC[N+](CC)(CC)CC)c3ccccc3C2(C)C)sc2ccccc21 |
| InChI | InChI=1S/C38H51N3O2S/c1-7-41(8-2,9-3)30-20-28-39-32-22-17-16-21-31(32)38(5,6)35(39)25-14-12-11-13-15-26-36-40(29-27-37(42)43-10-4)33-23-18-19-24-34(33)44-36/h11-19,21-26H,7-10,20,27-30H2,1-6H3/q+2 |
| InChIKey | BYWTZMVHDKTWSJ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.91 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|