C18H23N3O — CID 143641192
ethane;1-[4-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]amino]phenyl]ethanone (PubChem CID 143641192) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is ethane;1-[4-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]amino]phenyl]ethanone.
| Compound Name | ethane;1-[4-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 143641192 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | ethane;1-[4-[[4-ethenyl-5-[(Z)-prop-1-enyl]-1H-imidazol-2-yl]amino]phenyl]ethanone |
| SMILES | C=Cc1nc(Nc2ccc(C(C)=O)cc2)[nH]c1/C=C\C.CC |
| InChI | InChI=1S/C16H17N3O.C2H6/c1-4-6-15-14(5-2)18-16(19-15)17-13-9-7-12(8-10-13)11(3)20;1-2/h4-10H,2H2,1,3H3,(H2,17,18,19);1-2H3/b6-4-; |
| InChIKey | BRFSLXHSIZQLBF-YHSAGPEESA-N |
| XLogP | 5.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |