C20H32N4O4 — CID 143641912
(2S)-2-[[formyl-[2-[methyl(propyl)amino]phenyl]carbamoyl]amino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide (PubChem CID 143641912) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2S)-2-[[formyl-[2-[methyl(propyl)amino]phenyl]carbamoyl]amino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-[[formyl-[2-[methyl(propyl)amino]phenyl]carbamoyl]amino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143641912 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2S)-2-[[formyl-[2-[methyl(propyl)amino]phenyl]carbamoyl]amino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide |
| SMILES | CCCN(C)c1ccccc1N(C=O)C(=O)N[C@H](C(=O)NCCO)C(C)(C)C |
| InChI | InChI=1S/C20H32N4O4/c1-6-12-23(5)15-9-7-8-10-16(15)24(14-26)19(28)22-17(20(2,3)4)18(27)21-11-13-25/h7-10,14,17,25H,6,11-13H2,1-5H3,(H,21,27)(H,22,28)/t17-/m1/s1 |
| InChIKey | XXQHHBTWQMCJQR-QGZVFWFLSA-N |
| XLogP | 1.73 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|