C15H22F7I — CID 14364441
(E)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)tetradec-3-ene (PubChem CID 14364441) has the molecular formula C15H22F7I and a molecular weight of 462.23 g/mol. Its IUPAC name is (E)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)tetradec-3-ene.
| Compound Name | (E)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)tetradec-3-ene |
|---|---|
| PubChem CID | 14364441 |
| Molecular Formula | C15H22F7I |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | (E)-1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)tetradec-3-ene |
| SMILES | CCCCCCCCCC/C(I)=C\C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F7I/c1-2-3-4-5-6-7-8-9-10-12(23)11-13(16,14(17,18)19)15(20,21)22/h11H,2-10H2,1H3/b12-11+ |
| InChIKey | MEWQLLKWFCRTPH-VAWYXSNFSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|