C9H9F6FeO2- — CID 143646929
(Z)-4-butan-2-yloxy-1,1,1,5,5,5-hexafluoropent-3-en-2-one;iron (PubChem CID 143646929) has the molecular formula C9H9F6FeO2- and a molecular weight of 319.00 g/mol. Its IUPAC name is (Z)-4-butan-2-yloxy-1,1,1,5,5,5-hexafluoropent-3-en-2-one;iron.
| Compound Name | (Z)-4-butan-2-yloxy-1,1,1,5,5,5-hexafluoropent-3-en-2-one;iron |
|---|---|
| PubChem CID | 143646929 |
| Molecular Formula | C9H9F6FeO2- |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | (Z)-4-butan-2-yloxy-1,1,1,5,5,5-hexafluoropent-3-en-2-one;iron |
| SMILES | CC[C-](C)O/C(=C\C(=O)C(F)(F)F)C(F)(F)F.[Fe] |
| InChI | InChI=1S/C9H9F6O2.Fe/c1-3-5(2)17-7(9(13,14)15)4-6(16)8(10,11)12;/h4H,3H2,1-2H3;/q-1;/b7-4-; |
| InChIKey | JIFGTNBDUVDTMH-ZULQGGHCSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|