C10H8F6O4 — CID 166460707
(Z)-1,1,1,5,5,5-hexafluoro-4-[(Z)-4-oxopent-2-en-2-yl]peroxypent-3-en-2-one (PubChem CID 166460707) has the molecular formula C10H8F6O4 and a molecular weight of 306.16 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-[(Z)-4-oxopent-2-en-2-yl]peroxypent-3-en-2-one.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-[(Z)-4-oxopent-2-en-2-yl]peroxypent-3-en-2-one |
|---|---|
| PubChem CID | 166460707 |
| Molecular Formula | C10H8F6O4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-[(Z)-4-oxopent-2-en-2-yl]peroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C(/C)OO/C(=C\C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O4/c1-5(17)3-6(2)19-20-8(10(14,15)16)4-7(18)9(11,12)13/h3-4H,1-2H3/b6-3-,8-4- |
| InChIKey | VUOXEDYNDOZZAA-IJXUMNLFSA-N |
| XLogP | 3.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|