C20H27N7O2S — CID 143647157
4-[2-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-aminopropyl)-N-methylbenzenesulfonamide (PubChem CID 143647157) has the molecular formula C20H27N7O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-[2-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-aminopropyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-[2-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-aminopropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143647157 |
| Molecular Formula | C20H27N7O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-[2-[[amino-[(Z)-2-aminoethenyl]amino]methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-aminopropyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)c1ccc(-c2ccnc3[nH]c(CN(N)/C=C\N)cc23)cc1 |
| InChI | InChI=1S/C20H27N7O2S/c1-26(11-2-8-21)30(28,29)17-5-3-15(4-6-17)18-7-10-24-20-19(18)13-16(25-20)14-27(23)12-9-22/h3-7,9-10,12-13H,2,8,11,14,21-23H2,1H3,(H,24,25)/b12-9- |
| InChIKey | UIJPGTDGHJJYET-XFXZXTDPSA-N |
| XLogP | 1.30 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|