C25H30N7O2+ — CID 143651373
[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]ethyl]azanium (PubChem CID 143651373) has the molecular formula C25H30N7O2+ and a molecular weight of 460.56 g/mol. Its IUPAC name is [6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]ethyl]azanium.
| Compound Name | [6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 143651373 |
| Molecular Formula | C25H30N7O2+ |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]-[2-[[(E)-4-(dimethylamino)but-2-enoyl]amino]ethyl]azanium |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1[NH2+]CCNC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C25H29N7O2/c1-32(2)16-6-9-21(33)28-14-15-29-25-22(24(27)30-17-31-25)23(26)18-10-12-20(13-11-18)34-19-7-4-3-5-8-19/h3-13,17,26H,14-16H2,1-2H3,(H,28,33)(H3,27,29,30,31)/p+1/b9-6+,26-23+ |
| InChIKey | QUPMDDWQDYHTAI-XWCCYSOWSA-O |
| XLogP | 1.70 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|