C26H28FN3O6 — CID 143652215
1-ethoxycarbonyloxyethyl 3-[6-[2-(2-fluoro-6-methylphenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate (PubChem CID 143652215) has the molecular formula C26H28FN3O6 and a molecular weight of 497.52 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 3-[6-[2-(2-fluoro-6-methylphenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate.
| Compound Name | 1-ethoxycarbonyloxyethyl 3-[6-[2-(2-fluoro-6-methylphenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 143652215 |
| Molecular Formula | C26H28FN3O6 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 3-[6-[2-(2-fluoro-6-methylphenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate |
| SMILES | CCOC(=O)OC(C)OC(=O)c1cccc(-c2cc(NCCc3c(C)cccc3F)nc(OC)n2)c1 |
| InChI | InChI=1S/C26H28FN3O6/c1-5-34-26(32)36-17(3)35-24(31)19-10-7-9-18(14-19)22-15-23(30-25(29-22)33-4)28-13-12-20-16(2)8-6-11-21(20)27/h6-11,14-15,17H,5,12-13H2,1-4H3,(H,28,29,30) |
| InChIKey | GTMJQKNYMQBQAS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|