C25H27Cl2NO2 — CID 143653977
3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;5-(2,5-dichlorophenyl)-2-ethenylpyridine (PubChem CID 143653977) has the molecular formula C25H27Cl2NO2 and a molecular weight of 444.40 g/mol. Its IUPAC name is 3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;5-(2,5-dichlorophenyl)-2-ethenylpyridine.
| Compound Name | 3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;5-(2,5-dichlorophenyl)-2-ethenylpyridine |
|---|---|
| PubChem CID | 143653977 |
| Molecular Formula | C25H27Cl2NO2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][1]benzofuran-2-one;5-(2,5-dichlorophenyl)-2-ethenylpyridine |
| SMILES | C=Cc1ccc(-c2cc(Cl)ccc2Cl)cn1.O=C1CC2CC3CCCCC3CC2O1 |
| InChI | InChI=1S/C13H9Cl2N.C12H18O2/c1-2-11-5-3-9(8-16-11)12-7-10(14)4-6-13(12)15;13-12-7-10-5-8-3-1-2-4-9(8)6-11(10)14-12/h2-8H,1H2;8-11H,1-7H2 |
| InChIKey | DBIFLUWFOVUUDR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |