C23H27ClNO4S+ — CID 143656105
(3R,6S)-2-[4-chloro-5-(1H-indol-2-ylmethyl)-2-(methoxymethyl)phenyl]-6-(hydroxymethyl)thian-1-ium-3,4-diol (PubChem CID 143656105) has the molecular formula C23H27ClNO4S+ and a molecular weight of 448.99 g/mol. Its IUPAC name is (3R,6S)-2-[4-chloro-5-(1H-indol-2-ylmethyl)-2-(methoxymethyl)phenyl]-6-(hydroxymethyl)thian-1-ium-3,4-diol.
| Compound Name | (3R,6S)-2-[4-chloro-5-(1H-indol-2-ylmethyl)-2-(methoxymethyl)phenyl]-6-(hydroxymethyl)thian-1-ium-3,4-diol |
|---|---|
| PubChem CID | 143656105 |
| Molecular Formula | C23H27ClNO4S+ |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (3R,6S)-2-[4-chloro-5-(1H-indol-2-ylmethyl)-2-(methoxymethyl)phenyl]-6-(hydroxymethyl)thian-1-ium-3,4-diol |
| SMILES | COCc1cc(Cl)c(Cc2cc3ccccc3[nH]2)cc1C1[SH+][C@H](CO)CC(O)[C@H]1O |
| InChI | InChI=1S/C23H26ClNO4S/c1-29-12-15-9-19(24)14(7-16-6-13-4-2-3-5-20(13)25-16)8-18(15)23-22(28)21(27)10-17(11-26)30-23/h2-6,8-9,17,21-23,25-28H,7,10-12H2,1H3/p+1/t17-,21?,22+,23?/m0/s1 |
| InChIKey | QHJFKEYUUMEUKV-FZHPWLFESA-O |
| XLogP | 2.90 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|