C22H22ClNO5S — CID 59278905
(3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 59278905) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59278905 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-(1H-indol-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | OC[C@H]1S[C@]2(OCc3cc(Cl)c(Cc4cc5ccccc5[nH]4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22ClNO5S/c23-16-8-13-10-29-22(21(28)20(27)19(26)18(9-25)30-22)15(13)7-12(16)6-14-5-11-3-1-2-4-17(11)24-14/h1-5,7-8,18-21,24-28H,6,9-10H2/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | RVBPJMBACLRCOW-BDHVOXNPSA-N |
| XLogP | 2.29 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |