C21H23ClO6S — CID 59278949
(3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 59278949) has the molecular formula C21H23ClO6S and a molecular weight of 438.93 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59278949 |
| Molecular Formula | C21H23ClO6S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | COc1ccc(Cc2cc3c(cc2Cl)CO[C@]32S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H23ClO6S/c1-27-14-4-2-11(3-5-14)6-12-7-15-13(8-16(12)22)10-28-21(15)20(26)19(25)18(24)17(9-23)29-21/h2-5,7-8,17-20,23-26H,6,9-10H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JQTPEFRPKOBENK-ADAARDCZSA-N |
| XLogP | 1.81 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |