C22H23F3O6S — CID 59279039
(3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methyl-5-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol (PubChem CID 59279039) has the molecular formula C22H23F3O6S and a molecular weight of 472.48 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methyl-5-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methyl-5-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59279039 |
| Molecular Formula | C22H23F3O6S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methyl-5-[[4-(trifluoromethoxy)phenyl]methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4',5'-triol |
| SMILES | Cc1cc2c(cc1Cc1ccc(OC(F)(F)F)cc1)[C@]1(OC2)S[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H23F3O6S/c1-11-6-14-10-30-21(20(29)19(28)18(27)17(9-26)32-21)16(14)8-13(11)7-12-2-4-15(5-3-12)31-22(23,24)25/h2-6,8,17-20,26-29H,7,9-10H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | GHVLOUBPYZTJGU-ADAARDCZSA-N |
| XLogP | 2.36 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |