C21H23ClO5S — CID 143656123
(3S,3'R,4'S,6'S)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4'-diol (PubChem CID 143656123) has the molecular formula C21H23ClO5S and a molecular weight of 422.93 g/mol. Its IUPAC name is (3S,3'R,4'S,6'S)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4'-diol.
| Compound Name | (3S,3'R,4'S,6'S)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4'-diol |
|---|---|
| PubChem CID | 143656123 |
| Molecular Formula | C21H23ClO5S |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (3S,3'R,4'S,6'S)-6-chloro-6'-(hydroxymethyl)-5-[(4-methoxyphenyl)methyl]spiro[1H-2-benzofuran-3,2'-thiane]-3',4'-diol |
| SMILES | COc1ccc(Cc2cc3c(cc2Cl)CO[C@]32S[C@H](CO)C[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H23ClO5S/c1-26-15-4-2-12(3-5-15)6-13-7-17-14(8-18(13)22)11-27-21(17)20(25)19(24)9-16(10-23)28-21/h2-5,7-8,16,19-20,23-25H,6,9-11H2,1H3/t16-,19-,20+,21-/m0/s1 |
| InChIKey | RPCMKDMUXAMSTK-DVWBAYGPSA-N |
| XLogP | 2.84 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |