C20H25ClO5S2 — CID 143656082
(2S,3R,4R,5S,6R)-2-[4-chloro-2-(methoxymethyl)-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 143656082) has the molecular formula C20H25ClO5S2 and a molecular weight of 445.00 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-2-(methoxymethyl)-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-(methoxymethyl)-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 143656082 |
| Molecular Formula | C20H25ClO5S2 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-2-(methoxymethyl)-5-[(5-methylthiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | COCc1cc(Cl)c(Cc2ccc(C)s2)cc1[C@@H]1S[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25ClO5S2/c1-10-3-4-13(27-10)5-11-6-14(12(9-26-2)7-15(11)21)20-19(25)18(24)17(23)16(8-22)28-20/h3-4,6-7,16-20,22-25H,5,8-9H2,1-2H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | ZVTVEQJTHWIGTK-OBKDMQGPSA-N |
| XLogP | 2.68 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |