C22H29ClO6S — CID 146349857
(2S,3R,4S,5S,6R)-2-[4-chloro-5-[[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]methyl]-2-(methoxymethyl)phenyl]-2,6-dimethyloxane-3,4,5-triol (PubChem CID 146349857) has the molecular formula C22H29ClO6S and a molecular weight of 456.99 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-5-[[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]methyl]-2-(methoxymethyl)phenyl]-2,6-dimethyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-5-[[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]methyl]-2-(methoxymethyl)phenyl]-2,6-dimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 146349857 |
| Molecular Formula | C22H29ClO6S |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-5-[[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]methyl]-2-(methoxymethyl)phenyl]-2,6-dimethyloxane-3,4,5-triol |
| SMILES | COCc1cc(Cl)c(Cc2ccc([C@@H](C)O)s2)cc1[C@]1(C)O[C@H](C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H29ClO6S/c1-11(24)18-6-5-15(30-18)7-13-8-16(14(10-28-4)9-17(13)23)22(3)21(27)20(26)19(25)12(2)29-22/h5-6,8-9,11-12,19-21,24-27H,7,10H2,1-4H3/t11-,12-,19-,20+,21-,22+/m1/s1 |
| InChIKey | PUYOYIDHIQNYMJ-PQJVMTIOSA-N |
| XLogP | 2.91 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |