C17H27NO6 — CID 143657179
2-(2-hydroxyethoxy)ethyl 2-amino-3,4-dihydroxy-6-(4-methylphenyl)hexanoate (PubChem CID 143657179) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-amino-3,4-dihydroxy-6-(4-methylphenyl)hexanoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-amino-3,4-dihydroxy-6-(4-methylphenyl)hexanoate |
|---|---|
| PubChem CID | 143657179 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-amino-3,4-dihydroxy-6-(4-methylphenyl)hexanoate |
| SMILES | Cc1ccc(CCC(O)C(O)C(N)C(=O)OCCOCCO)cc1 |
| InChI | InChI=1S/C17H27NO6/c1-12-2-4-13(5-3-12)6-7-14(20)16(21)15(18)17(22)24-11-10-23-9-8-19/h2-5,14-16,19-21H,6-11,18H2,1H3 |
| InChIKey | GNLRBEBKSYCGNB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|