C11H17FN2O2 — CID 143657562
N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-3-oxopropanamide;N-methylmethanamine (PubChem CID 143657562) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-3-oxopropanamide;N-methylmethanamine.
| Compound Name | N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-3-oxopropanamide;N-methylmethanamine |
|---|---|
| PubChem CID | 143657562 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-3-oxopropanamide;N-methylmethanamine |
| SMILES | C=C/C=C(/NC(=O)CC=O)C(=C)F.CNC |
| InChI | InChI=1S/C9H10FNO2.C2H7N/c1-3-4-8(7(2)10)11-9(13)5-6-12;1-3-2/h3-4,6H,1-2,5H2,(H,11,13);3H,1-2H3/b8-4+; |
| InChIKey | HNOSDYCDLWBQMM-ZFXMFRGYSA-N |
| XLogP | 1.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|