C12H19FN2O2 — CID 143768459
ethane;N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-methylpropanediamide (PubChem CID 143768459) has the molecular formula C12H19FN2O2 and a molecular weight of 242.29 g/mol. Its IUPAC name is ethane;N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-methylpropanediamide.
| Compound Name | ethane;N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 143768459 |
| Molecular Formula | C12H19FN2O2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | ethane;N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-N'-methylpropanediamide |
| SMILES | C=C/C=C(\C(=C)F)N(C)C(=O)CC(N)=O.CC |
| InChI | InChI=1S/C10H13FN2O2.C2H6/c1-4-5-8(7(2)11)13(3)10(15)6-9(12)14;1-2/h4-5H,1-2,6H2,3H3,(H2,12,14);1-2H3/b8-5+; |
| InChIKey | MXAMIUIJQJFTTH-HAAWTFQLSA-N |
| XLogP | 1.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|