C10H14N2O2 — CID 143768501
N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanediamide (PubChem CID 143768501) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanediamide.
| Compound Name | N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanediamide |
|---|---|
| PubChem CID | 143768501 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N'-[(3E)-hexa-1,3,5-trien-3-yl]-N-methylpropanediamide |
| SMILES | C=C/C=C(\C=C)NC(=O)CC(=O)NC |
| InChI | InChI=1S/C10H14N2O2/c1-4-6-8(5-2)12-10(14)7-9(13)11-3/h4-6H,1-2,7H2,3H3,(H,11,13)(H,12,14)/b8-6+ |
| InChIKey | LBHAOOPQINYNTK-SOFGYWHQSA-N |
| XLogP | 0.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|