C21H34N4O4S — CID 143661603
N-[(2R)-1-(cyclopropylsulfanylamino)-2-methyl-1-oxopent-4-en-2-yl]-1-[(2S)-2-formamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 143661603) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[(2R)-1-(cyclopropylsulfanylamino)-2-methyl-1-oxopent-4-en-2-yl]-1-[(2S)-2-formamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2R)-1-(cyclopropylsulfanylamino)-2-methyl-1-oxopent-4-en-2-yl]-1-[(2S)-2-formamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143661603 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[(2R)-1-(cyclopropylsulfanylamino)-2-methyl-1-oxopent-4-en-2-yl]-1-[(2S)-2-formamido-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=CC[C@@](C)(NC(=O)C1CCCN1C(=O)[C@@H](NC=O)C(C)(C)C)C(=O)NSC1CC1 |
| InChI | InChI=1S/C21H34N4O4S/c1-6-11-21(5,19(29)24-30-14-9-10-14)23-17(27)15-8-7-12-25(15)18(28)16(22-13-26)20(2,3)4/h6,13-16H,1,7-12H2,2-5H3,(H,22,26)(H,23,27)(H,24,29)/t15?,16-,21-/m1/s1 |
| InChIKey | MGNYFGUSVMFCLV-VWDLYUFVSA-N |
| XLogP | 1.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|