C16H26FNO — CID 143661689
1-ethyl-3-fluoro-2-(2-methylprop-2-enyl)benzene;formamide;propane (PubChem CID 143661689) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-ethyl-3-fluoro-2-(2-methylprop-2-enyl)benzene;formamide;propane.
| Compound Name | 1-ethyl-3-fluoro-2-(2-methylprop-2-enyl)benzene;formamide;propane |
|---|---|
| PubChem CID | 143661689 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-ethyl-3-fluoro-2-(2-methylprop-2-enyl)benzene;formamide;propane |
| SMILES | C=C(C)Cc1c(F)cccc1CC.CCC.NC=O |
| InChI | InChI=1S/C12H15F.C3H8.CH3NO/c1-4-10-6-5-7-12(13)11(10)8-9(2)3;1-3-2;2-1-3/h5-7H,2,4,8H2,1,3H3;3H2,1-2H3;1H,(H2,2,3) |
| InChIKey | YLISKAAQRCYZSX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|