C12H20ClNO — CID 143662335
(2E,3E)-5-chloro-2-ethylidene-3-(methylamino)hexa-3,5-dienal;propane (PubChem CID 143662335) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is (2E,3E)-5-chloro-2-ethylidene-3-(methylamino)hexa-3,5-dienal;propane.
| Compound Name | (2E,3E)-5-chloro-2-ethylidene-3-(methylamino)hexa-3,5-dienal;propane |
|---|---|
| PubChem CID | 143662335 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (2E,3E)-5-chloro-2-ethylidene-3-(methylamino)hexa-3,5-dienal;propane |
| SMILES | C=C(Cl)/C=C(NC)/C(C=O)=C\C.CCC |
| InChI | InChI=1S/C9H12ClNO.C3H8/c1-4-8(6-12)9(11-3)5-7(2)10;1-3-2/h4-6,11H,2H2,1,3H3;3H2,1-2H3/b8-4+,9-5+; |
| InChIKey | ZSEKUYPNWBHDSQ-VYMJFYGFSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|