About (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one
(4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one (PubChem CID 143116447) has the molecular formula C11H15Cl2NO
and a molecular weight of 248.15 g/mol. Its IUPAC name is (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one.
Molecular Properties
| Compound Name | (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one |
| PubChem CID | 143116447 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one |
| SMILES | C=C(Cl)/C=C(/Cl)C(=CC)C(=O)CNCC |
| InChI | InChI=1S/C11H15Cl2NO/c1-4-9(10(13)6-8(3)12)11(15)7-14-5-2/h4,6,14H,3,5,7H2,1-2H3/b9-4?,10-6+ |
| InChIKey | OYMOAUNYOWWZQF-CWLNOYFLSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one?
The IUPAC name of (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one (CID 143116447) is (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one.
What is the SMILES notation for (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one?
The canonical SMILES for (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one is C=C(Cl)/C=C(/Cl)C(=CC)C(=O)CNCC.
What is the InChIKey of (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one?
The InChIKey is OYMOAUNYOWWZQF-CWLNOYFLSA-N. The full InChI is InChI=1S/C11H15Cl2NO/c1-4-9(10(13)6-8(3)12)11(15)7-14-5-2/h4,6,14H,3,5,7H2,1-2H3/b9-4?,10-6+.
What are the key properties of (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one?
(4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one has a molecular weight of 248.15 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one is sourced from PubChem (CID 143116447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).