C11H15Cl2NO — CID 143116447
(4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one (PubChem CID 143116447) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one.
| Compound Name | (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 143116447 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (4E)-4,6-dichloro-1-(ethylamino)-3-ethylidenehepta-4,6-dien-2-one |
| SMILES | C=C(Cl)/C=C(/Cl)C(=CC)C(=O)CNCC |
| InChI | InChI=1S/C11H15Cl2NO/c1-4-9(10(13)6-8(3)12)11(15)7-14-5-2/h4,6,14H,3,5,7H2,1-2H3/b9-4?,10-6+ |
| InChIKey | OYMOAUNYOWWZQF-CWLNOYFLSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|