C25H34ClN3O2 — CID 143664711
(3-chloro-4-hydroxyphenyl)-[2-[4-[[2-[ethyl(propyl)amino]ethylamino]methyl]phenyl]pyrrolidin-1-yl]methanone (PubChem CID 143664711) has the molecular formula C25H34ClN3O2 and a molecular weight of 444.02 g/mol. Its IUPAC name is (3-chloro-4-hydroxyphenyl)-[2-[4-[[2-[ethyl(propyl)amino]ethylamino]methyl]phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (3-chloro-4-hydroxyphenyl)-[2-[4-[[2-[ethyl(propyl)amino]ethylamino]methyl]phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 143664711 |
| Molecular Formula | C25H34ClN3O2 |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (3-chloro-4-hydroxyphenyl)-[2-[4-[[2-[ethyl(propyl)amino]ethylamino]methyl]phenyl]pyrrolidin-1-yl]methanone |
| SMILES | CCCN(CC)CCNCc1ccc(C2CCCN2C(=O)c2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H34ClN3O2/c1-3-14-28(4-2)16-13-27-18-19-7-9-20(10-8-19)23-6-5-15-29(23)25(31)21-11-12-24(30)22(26)17-21/h7-12,17,23,27,30H,3-6,13-16,18H2,1-2H3 |
| InChIKey | VEVSXDIKHLNVBT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|