About 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde
2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde (PubChem CID 143668410) has the molecular formula C15H24ClNO3
and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde.
Molecular Properties
| Compound Name | 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde |
| PubChem CID | 143668410 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde |
| SMILES | C=O.C=O.CC.COC1CCC(c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C11H14ClNO.C2H6.2CH2O/c1-14-10-4-2-8(6-10)9-3-5-11(12)13-7-9;3*1-2/h3,5,7-8,10H,2,4,6H2,1H3;1-2H3;2*1H2 |
| InChIKey | PGXKFQGHIMBKNN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde?
The IUPAC name of 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde (CID 143668410) is 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde.
What is the SMILES notation for 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde?
The canonical SMILES for 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde is C=O.C=O.CC.COC1CCC(c2ccc(Cl)nc2)C1.
What is the InChIKey of 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde?
The InChIKey is PGXKFQGHIMBKNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO.C2H6.2CH2O/c1-14-10-4-2-8(6-10)9-3-5-11(12)13-7-9;3*1-2/h3,5,7-8,10H,2,4,6H2,1H3;1-2H3;2*1H2.
What are the key properties of 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde?
2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde has a molecular weight of 301.81 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde is sourced from PubChem (CID 143668410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).