C15H24ClNO3 — CID 143668410
2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde (PubChem CID 143668410) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde.
| Compound Name | 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde |
|---|---|
| PubChem CID | 143668410 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-chloro-5-(3-methoxycyclopentyl)pyridine;ethane;formaldehyde |
| SMILES | C=O.C=O.CC.COC1CCC(c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C11H14ClNO.C2H6.2CH2O/c1-14-10-4-2-8(6-10)9-3-5-11(12)13-7-9;3*1-2/h3,5,7-8,10H,2,4,6H2,1H3;1-2H3;2*1H2 |
| InChIKey | PGXKFQGHIMBKNN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|